C21H26N2O3 — CID 102121233
methyl (1'R,7'S,8'S,9'S)-9'-ethyl-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate (PubChem CID 102121233) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl (1'R,7'S,8'S,9'S)-9'-ethyl-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate.
| Compound Name | methyl (1'R,7'S,8'S,9'S)-9'-ethyl-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate |
|---|---|
| PubChem CID | 102121233 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | methyl (1'R,7'S,8'S,9'S)-9'-ethyl-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate |
| SMILES | CC[C@H]1C[C@H]2CN3CCC4(Nc5ccccc5C4=O)[C@](C(=O)OC)(C2)[C@H]13 |
| InChI | InChI=1S/C21H26N2O3/c1-3-14-10-13-11-20(19(25)26-2)17(14)23(12-13)9-8-21(20)18(24)15-6-4-5-7-16(15)22-21/h4-7,13-14,17,22H,3,8-12H2,1-2H3/t13-,14+,17+,20-,21?/m1/s1 |
| InChIKey | BXHQWEMRWSKGAS-AAULNZKKSA-N |
| XLogP | 2.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |