C20H26N2O3 — CID 153284539
methyl 2-[(2R,8'S,8'aS)-8'-ethyl-3-oxospiro[1H-indole-2,1'-2,3,5,6,7,8a-hexahydroindolizine]-8'-yl]acetate (PubChem CID 153284539) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 2-[(2R,8'S,8'aS)-8'-ethyl-3-oxospiro[1H-indole-2,1'-2,3,5,6,7,8a-hexahydroindolizine]-8'-yl]acetate.
| Compound Name | methyl 2-[(2R,8'S,8'aS)-8'-ethyl-3-oxospiro[1H-indole-2,1'-2,3,5,6,7,8a-hexahydroindolizine]-8'-yl]acetate |
|---|---|
| PubChem CID | 153284539 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | methyl 2-[(2R,8'S,8'aS)-8'-ethyl-3-oxospiro[1H-indole-2,1'-2,3,5,6,7,8a-hexahydroindolizine]-8'-yl]acetate |
| SMILES | CC[C@@]1(CC(=O)OC)CCCN2CC[C@@]3(Nc4ccccc4C3=O)[C@@H]21 |
| InChI | InChI=1S/C20H26N2O3/c1-3-19(13-16(23)25-2)9-6-11-22-12-10-20(18(19)22)17(24)14-7-4-5-8-15(14)21-20/h4-5,7-8,18,21H,3,6,9-13H2,1-2H3/t18-,19-,20-/m0/s1 |
| InChIKey | VTNDOQSNNWSBBA-UFYCRDLUSA-N |
| XLogP | 2.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |