C19H25IN2O3 — CID 166761512
methyl 2-ethyl-4-iodo-2-(1'-methyl-3-oxospiro[1H-indole-2,3'-pyrrolidine]-2'-yl)butanoate (PubChem CID 166761512) has the molecular formula C19H25IN2O3 and a molecular weight of 456.32 g/mol. Its IUPAC name is methyl 2-ethyl-4-iodo-2-(1'-methyl-3-oxospiro[1H-indole-2,3'-pyrrolidine]-2'-yl)butanoate.
| Compound Name | methyl 2-ethyl-4-iodo-2-(1'-methyl-3-oxospiro[1H-indole-2,3'-pyrrolidine]-2'-yl)butanoate |
|---|---|
| PubChem CID | 166761512 |
| Molecular Formula | C19H25IN2O3 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | methyl 2-ethyl-4-iodo-2-(1'-methyl-3-oxospiro[1H-indole-2,3'-pyrrolidine]-2'-yl)butanoate |
| SMILES | CCC(CCI)(C(=O)OC)C1N(C)CCC12Nc1ccccc1C2=O |
| InChI | InChI=1S/C19H25IN2O3/c1-4-18(9-11-20,17(24)25-3)16-19(10-12-22(16)2)15(23)13-7-5-6-8-14(13)21-19/h5-8,16,21H,4,9-12H2,1-3H3 |
| InChIKey | AOGXAGYMZYYTQG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|