C21H26N2O4 — CID 139045392
methyl (1'R,2S,7'S,8'S,9'S)-9'-[(1S)-1-hydroxyethyl]-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate (PubChem CID 139045392) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl (1'R,2S,7'S,8'S,9'S)-9'-[(1S)-1-hydroxyethyl]-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate.
| Compound Name | methyl (1'R,2S,7'S,8'S,9'S)-9'-[(1S)-1-hydroxyethyl]-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate |
|---|---|
| PubChem CID | 139045392 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | methyl (1'R,2S,7'S,8'S,9'S)-9'-[(1S)-1-hydroxyethyl]-3-oxospiro[1H-indole-2,6'-3-azatricyclo[5.3.1.03,8]undecane]-7'-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@H]3C[C@H]([C@H](C)O)[C@@H]1N(CC[C@]21Nc2ccccc2C1=O)C3 |
| InChI | InChI=1S/C21H26N2O4/c1-12(24)15-9-13-10-20(19(26)27-2)17(15)23(11-13)8-7-21(20)18(25)14-5-3-4-6-16(14)22-21/h3-6,12-13,15,17,22,24H,7-11H2,1-2H3/t12-,13+,15+,17-,20+,21+/m0/s1 |
| InChIKey | RDHMPSLUMICWSU-HXCNISCMSA-N |
| XLogP | 1.69 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |