C20H20N2O5 — CID 102122094
phenyl (1Z)-N-[2-(5-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isochromen-5-yl)acetyl]methanehydrazonate (PubChem CID 102122094) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is phenyl (1Z)-N-[2-(5-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isochromen-5-yl)acetyl]methanehydrazonate.
| Compound Name | phenyl (1Z)-N-[2-(5-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isochromen-5-yl)acetyl]methanehydrazonate |
|---|---|
| PubChem CID | 102122094 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | phenyl (1Z)-N-[2-(5-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isochromen-5-yl)acetyl]methanehydrazonate |
| SMILES | CC1(CC(=O)N/N=C\Oc2ccccc2)OCCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C20H20N2O5/c1-20(11-19(23)22-21-12-24-15-5-3-2-4-6-15)16-10-18-17(25-13-26-18)9-14(16)7-8-27-20/h2-6,9-10,12H,7-8,11,13H2,1H3,(H,22,23)/b21-12- |
| InChIKey | HEBDCMKJJMGVTH-MTJSOVHGSA-N |
| XLogP | 2.73 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|