C16H10N2O6 — CID 102123397
[4-(4-hydroxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(4-hydroxyphenyl)methanone (PubChem CID 102123397) has the molecular formula C16H10N2O6 and a molecular weight of 326.26 g/mol. Its IUPAC name is [4-(4-hydroxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [4-(4-hydroxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 102123397 |
| Molecular Formula | C16H10N2O6 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [4-(4-hydroxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)c1no[n+]([O-])c1C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H10N2O6/c19-11-5-1-9(2-6-11)15(21)13-14(18(23)24-17-13)16(22)10-3-7-12(20)8-4-10/h1-8,19-20H |
| InChIKey | UZFKEAKTWDOHNF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|