C19H28N6 — CID 102124658
1-(1-tert-butyltetrazol-5-yl)-N-[2-(1H-indol-3-yl)ethyl]butan-1-amine (PubChem CID 102124658) has the molecular formula C19H28N6 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(1-tert-butyltetrazol-5-yl)-N-[2-(1H-indol-3-yl)ethyl]butan-1-amine.
| Compound Name | 1-(1-tert-butyltetrazol-5-yl)-N-[2-(1H-indol-3-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 102124658 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-(1-tert-butyltetrazol-5-yl)-N-[2-(1H-indol-3-yl)ethyl]butan-1-amine |
| SMILES | CCCC(NCCc1c[nH]c2ccccc12)c1nnnn1C(C)(C)C |
| InChI | InChI=1S/C19H28N6/c1-5-8-17(18-22-23-24-25(18)19(2,3)4)20-12-11-14-13-21-16-10-7-6-9-15(14)16/h6-7,9-10,13,17,20-21H,5,8,11-12H2,1-4H3 |
| InChIKey | UKOCVTXKXFDHEV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |