C17H15N3O2S — CID 102126969
S-pyrrolidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate (PubChem CID 102126969) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is S-pyrrolidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate.
| Compound Name | S-pyrrolidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate |
|---|---|
| PubChem CID | 102126969 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | S-pyrrolidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate |
| SMILES | O=C(SN1CCCC1)n1c2ccccc2c(=O)c2ccncc21 |
| InChI | InChI=1S/C17H15N3O2S/c21-16-12-5-1-2-6-14(12)20(15-11-18-8-7-13(15)16)17(22)23-19-9-3-4-10-19/h1-2,5-8,11H,3-4,9-10H2 |
| InChIKey | UXTRQMRLNLKOKJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|