C23H21N2OP — CID 102127914
diphenyl-[[(4S)-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl]oxy]phosphane (PubChem CID 102127914) has the molecular formula C23H21N2OP and a molecular weight of 372.41 g/mol. Its IUPAC name is diphenyl-[[(4S)-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl]oxy]phosphane.
| Compound Name | diphenyl-[[(4S)-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl]oxy]phosphane |
|---|---|
| PubChem CID | 102127914 |
| Molecular Formula | C23H21N2OP |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | diphenyl-[[(4S)-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl]oxy]phosphane |
| SMILES | c1ccc(P(O[C@H]2CCCn3c2nc2ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N2OP/c1-3-10-18(11-4-1)27(19-12-5-2-6-13-19)26-22-16-9-17-25-21-15-8-7-14-20(21)24-23(22)25/h1-8,10-15,22H,9,16-17H2/t22-/m0/s1 |
| InChIKey | PNDPGQGNRPGUGV-QFIPXVFZSA-N |
| XLogP | 4.94 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|