C19H38O4Si2 — CID 102127983
(4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxycyclohex-2-en-1-one (PubChem CID 102127983) has the molecular formula C19H38O4Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is (4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxycyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102127983 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxycyclohex-2-en-1-one |
| SMILES | CO[C@@H]1C(=O)C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4Si2/c1-18(2,3)24(8,9)22-15-13-12-14(20)16(21-7)17(15)23-25(10,11)19(4,5)6/h12-13,15-17H,1-11H3/t15-,16+,17+/m0/s1 |
| InChIKey | KSVCJFCFJAPLKQ-GVDBMIGSSA-N |
| XLogP | 4.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|