C27H24O7 — CID 102128874
(1R,9S,10R,11S,14S)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8,13-dioxatetracyclo[7.5.0.02,7.011,14]tetradeca-2(7),3,5-trien-12-one (PubChem CID 102128874) has the molecular formula C27H24O7 and a molecular weight of 460.48 g/mol. Its IUPAC name is (1R,9S,10R,11S,14S)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8,13-dioxatetracyclo[7.5.0.02,7.011,14]tetradeca-2(7),3,5-trien-12-one.
| Compound Name | (1R,9S,10R,11S,14S)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8,13-dioxatetracyclo[7.5.0.02,7.011,14]tetradeca-2(7),3,5-trien-12-one |
|---|---|
| PubChem CID | 102128874 |
| Molecular Formula | C27H24O7 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (1R,9S,10R,11S,14S)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8,13-dioxatetracyclo[7.5.0.02,7.011,14]tetradeca-2(7),3,5-trien-12-one |
| SMILES | COc1ccc([C@]23Oc4cc(OC)cc(OC)c4[C@@]2(O)[C@H]2OC(=O)[C@H]2[C@@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24O7/c1-30-17-11-9-16(10-12-17)27-22(15-7-5-4-6-8-15)21-24(33-25(21)28)26(27,29)23-19(32-3)13-18(31-2)14-20(23)34-27/h4-14,21-22,24,29H,1-3H3/t21-,22-,24-,26+,27+/m0/s1 |
| InChIKey | OFFBQQGXZVASRE-DSVANHEQSA-N |
| XLogP | 3.53 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|