C26H27NO6 — CID 167066135
(1R,2R,3aR)-2-amino-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 167066135) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is (1R,2R,3aR)-2-amino-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1R,2R,3aR)-2-amino-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 167066135 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (1R,2R,3aR)-2-amino-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | COc1ccc([C@@]23Oc4cc(OC)cc(OC)c4C2(O)[C@H](O)[C@H](N)C3c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO6/c1-30-17-11-9-16(10-12-17)26-21(15-7-5-4-6-8-15)23(27)24(28)25(26,29)22-19(32-3)13-18(31-2)14-20(22)33-26/h4-14,21,23-24,28-29H,27H2,1-3H3/t21?,23-,24-,25?,26+/m1/s1 |
| InChIKey | IODVJABHHRIHGX-HDDLOASHSA-N |
| XLogP | 2.67 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |