C30H33NO8 — CID 129114315
(1S,2S,3R,3aS,8bR)-6-(4-aminobutoxy)-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid (PubChem CID 129114315) has the molecular formula C30H33NO8 and a molecular weight of 535.59 g/mol. Its IUPAC name is (1S,2S,3R,3aS,8bR)-6-(4-aminobutoxy)-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid.
| Compound Name | (1S,2S,3R,3aS,8bR)-6-(4-aminobutoxy)-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 129114315 |
| Molecular Formula | C30H33NO8 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (1S,2S,3R,3aS,8bR)-6-(4-aminobutoxy)-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid |
| SMILES | COc1ccc([C@]23Oc4cc(OCCCCN)cc(OC)c4[C@@]2(O)[C@@H](O)[C@@H](C(=O)O)[C@@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C30H33NO8/c1-36-20-12-10-19(11-13-20)30-25(18-8-4-3-5-9-18)24(28(33)34)27(32)29(30,35)26-22(37-2)16-21(17-23(26)39-30)38-15-7-6-14-31/h3-5,8-13,16-17,24-25,27,32,35H,6-7,14-15,31H2,1-2H3,(H,33,34)/t24-,25-,27-,29+,30+/m0/s1 |
| InChIKey | ULLPINLCWJBCAB-AUQBDBNJSA-N |
| XLogP | 3.16 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|