C33H30O7 — CID 158186367
(1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-8-methoxy-6-methyl-3-phenyl-3a-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid (PubChem CID 158186367) has the molecular formula C33H30O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-8-methoxy-6-methyl-3-phenyl-3a-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid.
| Compound Name | (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-8-methoxy-6-methyl-3-phenyl-3a-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 158186367 |
| Molecular Formula | C33H30O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-8-methoxy-6-methyl-3-phenyl-3a-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid |
| SMILES | COc1cc(C)cc2c1[C@]1(O)[C@H](O)[C@H](C(=O)O)[C@@H](c3ccccc3)[C@]1(c1ccc(OCc3ccccc3)cc1)O2 |
| InChI | InChI=1S/C33H30O7/c1-20-17-25(38-2)29-26(18-20)40-33(23-13-15-24(16-14-23)39-19-21-9-5-3-6-10-21)28(22-11-7-4-8-12-22)27(31(35)36)30(34)32(29,33)37/h3-18,27-28,30,34,37H,19H2,1-2H3,(H,35,36)/t27-,28-,30-,32+,33+/m1/s1 |
| InChIKey | YBSPYWXEFGUBNT-SEOGXEBRSA-N |
| XLogP | 4.92 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |