C26H25NO5 — CID 158258083
(1S,2S,3R,3aS,8bR)-1,8b-dihydroxy-3a-(4-hydroxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 158258083) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is (1S,2S,3R,3aS,8bR)-1,8b-dihydroxy-3a-(4-hydroxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | (1S,2S,3R,3aS,8bR)-1,8b-dihydroxy-3a-(4-hydroxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 158258083 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (1S,2S,3R,3aS,8bR)-1,8b-dihydroxy-3a-(4-hydroxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | Cc1cc(C)c2c(c1)O[C@]1(c3ccc(O)cc3)[C@@H](c3ccccc3)[C@H](C(N)=O)[C@H](O)[C@]21O |
| InChI | InChI=1S/C26H25NO5/c1-14-12-15(2)21-19(13-14)32-26(17-8-10-18(28)11-9-17)22(16-6-4-3-5-7-16)20(24(27)30)23(29)25(21,26)31/h3-13,20,22-23,28-29,31H,1-2H3,(H2,27,30)/t20-,22-,23-,25+,26+/m0/s1 |
| InChIKey | JIKOXPUNWCSYEU-KJWOLZFWSA-N |
| XLogP | 2.74 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |