C24H22O7S — CID 102233435
(1R,2R,3S,3aS,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-3a-thiophen-2-yl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid (PubChem CID 102233435) has the molecular formula C24H22O7S and a molecular weight of 454.50 g/mol. Its IUPAC name is (1R,2R,3S,3aS,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-3a-thiophen-2-yl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid.
| Compound Name | (1R,2R,3S,3aS,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-3a-thiophen-2-yl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 102233435 |
| Molecular Formula | C24H22O7S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (1R,2R,3S,3aS,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-3a-thiophen-2-yl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylic acid |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3cccs3)[C@H](c3ccccc3)[C@@H](C(=O)O)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C24H22O7S/c1-29-14-11-15(30-2)20-16(12-14)31-24(17-9-6-10-32-17)19(13-7-4-3-5-8-13)18(22(26)27)21(25)23(20,24)28/h3-12,18-19,21,25,28H,1-2H3,(H,26,27)/t18-,19-,21-,23+,24+/m1/s1 |
| InChIKey | MLXOTADDRYPZJU-CLODTNMZSA-N |
| XLogP | 3.10 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |