C30H27NO7S — CID 56946321
[(1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 56946321) has the molecular formula C30H27NO7S and a molecular weight of 545.61 g/mol. Its IUPAC name is [(1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 56946321 |
| Molecular Formula | C30H27NO7S |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | [(1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | COc1ccc([C@@]23Oc4cc(OC)cc(OC)c4[C@]2(O)[C@H](O)[C@H](C(=O)c2nccs2)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27NO7S/c1-35-19-11-9-18(10-12-19)30-24(17-7-5-4-6-8-17)23(26(32)28-31-13-14-39-28)27(33)29(30,34)25-21(37-3)15-20(36-2)16-22(25)38-30/h4-16,23-24,27,33-34H,1-3H3/t23-,24+,27+,29-,30-/m0/s1 |
| InChIKey | LPBCYHKBBWTRKY-KRWCHEGISA-N |
| XLogP | 4.30 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |