C28H28O6 — CID 58193076
methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate (PubChem CID 58193076) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 58193076 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3c(C)cc(C)cc3O[C@@]2(c2ccc(OC)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H28O6/c1-16-14-17(2)23-21(15-16)34-28(19-10-12-20(32-3)13-11-19)24(18-8-6-5-7-9-18)22(26(30)33-4)25(29)27(23,28)31/h5-15,22,24-25,29,31H,1-4H3/t22-,24-,25-,27+,28+/m1/s1 |
| InChIKey | LBEVNSSRNRYPKT-KYNFNZIBSA-N |
| XLogP | 3.74 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |