C26H26O4 — CID 11486463
(1R,3S,3aR,8bS)-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 11486463) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is (1R,3S,3aR,8bS)-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1R,3S,3aR,8bS)-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 11486463 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (1R,3S,3aR,8bS)-3a-(4-methoxyphenyl)-6,8-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | COc1ccc([C@@]23Oc4cc(C)cc(C)c4[C@]2(O)[C@H](O)C[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O4/c1-16-13-17(2)24-22(14-16)30-26(19-9-11-20(29-3)12-10-19)21(15-23(27)25(24,26)28)18-7-5-4-6-8-18/h4-14,21,23,27-28H,15H2,1-3H3/t21-,23+,25+,26-/m0/s1 |
| InChIKey | MSZQZSWLTOAMKX-CMNQHTDYSA-N |
| XLogP | 4.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |