C26H25ClO5 — CID 46219536
3a-(4-chlorophenyl)-6-(2-methoxyethoxy)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 46219536) has the molecular formula C26H25ClO5 and a molecular weight of 452.93 g/mol. Its IUPAC name is 3a-(4-chlorophenyl)-6-(2-methoxyethoxy)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | 3a-(4-chlorophenyl)-6-(2-methoxyethoxy)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 46219536 |
| Molecular Formula | C26H25ClO5 |
| Molecular Weight | 452.93 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 3a-(4-chlorophenyl)-6-(2-methoxyethoxy)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | COCCOc1ccc2c(c1)OC1(c3ccc(Cl)cc3)C(c3ccccc3)CC(O)C21O |
| InChI | InChI=1S/C26H25ClO5/c1-30-13-14-31-20-11-12-21-23(15-20)32-26(18-7-9-19(27)10-8-18)22(16-24(28)25(21,26)29)17-5-3-2-4-6-17/h2-12,15,22,24,28-29H,13-14,16H2,1H3 |
| InChIKey | MYUFRGXIWPJXPY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|