C26H25ClN2O3 — CID 155929712
3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-8b-hydroxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea (PubChem CID 155929712) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is 3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-8b-hydroxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea.
| Compound Name | 3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-8b-hydroxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 155929712 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-8b-hydroxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N[C@H]1C[C@@H](c2ccccc2)[C@]2(c3ccc(Cl)cc3)Oc3ccccc3[C@]12O |
| InChI | InChI=1S/C26H25ClN2O3/c1-29(2)24(30)28-23-16-21(17-8-4-3-5-9-17)26(18-12-14-19(27)15-13-18)25(23,31)20-10-6-7-11-22(20)32-26/h3-15,21,23,31H,16H2,1-2H3,(H,28,30)/t21-,23-,25-,26-/m0/s1 |
| InChIKey | SOJWCXJKZKQXCH-WVADOKLZSA-N |
| XLogP | 4.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |