C30H32ClNO4 — CID 90946662
(1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 90946662) has the molecular formula C30H32ClNO4 and a molecular weight of 506.04 g/mol. Its IUPAC name is (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 90946662 |
| Molecular Formula | C30H32ClNO4 |
| Molecular Weight | 506.04 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | O[C@H]1C[C@H](c2ccccc2)[C@@]2(c3ccc(Cl)cc3)Oc3cc(OCCCN4CCCC4)ccc3[C@@]12O |
| InChI | InChI=1S/C30H32ClNO4/c31-23-11-9-22(10-12-23)30-26(21-7-2-1-3-8-21)20-28(33)29(30,34)25-14-13-24(19-27(25)36-30)35-18-6-17-32-15-4-5-16-32/h1-3,7-14,19,26,28,33-34H,4-6,15-18,20H2/t26-,28+,29-,30-/m1/s1 |
| InChIKey | XQSFVRMFBXLPNY-RRFVUZEHSA-N |
| XLogP | 5.23 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.04 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|