C27H27ClO5 — CID 91107305
(1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6,8-diethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 91107305) has the molecular formula C27H27ClO5 and a molecular weight of 466.96 g/mol. Its IUPAC name is (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6,8-diethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6,8-diethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 91107305 |
| Molecular Formula | C27H27ClO5 |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6,8-diethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | CCOc1cc(OCC)c2c(c1)O[C@]1(c3ccc(Cl)cc3)[C@@H](c3ccccc3)C[C@H](O)[C@]21O |
| InChI | InChI=1S/C27H27ClO5/c1-3-31-20-14-22(32-4-2)25-23(15-20)33-27(18-10-12-19(28)13-11-18)21(16-24(29)26(25,27)30)17-8-6-5-7-9-17/h5-15,21,24,29-30H,3-4,16H2,1-2H3/t21-,24+,26+,27-/m1/s1 |
| InChIKey | JQZSOAZDGLCRQA-JXHGYLODSA-N |
| XLogP | 5.16 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |