C28H33N3O5 — CID 163705286
(1R,3S,3aR,8bS)-6,8-bis(2-aminoethoxy)-3a-(4-aminophenyl)-1-methoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol (PubChem CID 163705286) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is (1R,3S,3aR,8bS)-6,8-bis(2-aminoethoxy)-3a-(4-aminophenyl)-1-methoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol.
| Compound Name | (1R,3S,3aR,8bS)-6,8-bis(2-aminoethoxy)-3a-(4-aminophenyl)-1-methoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol |
|---|---|
| PubChem CID | 163705286 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (1R,3S,3aR,8bS)-6,8-bis(2-aminoethoxy)-3a-(4-aminophenyl)-1-methoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol |
| SMILES | CO[C@@H]1C[C@@H](c2ccccc2)[C@]2(c3ccc(N)cc3)Oc3cc(OCCN)cc(OCCN)c3[C@]12O |
| InChI | InChI=1S/C28H33N3O5/c1-33-25-17-22(18-5-3-2-4-6-18)28(19-7-9-20(31)10-8-19)27(25,32)26-23(35-14-12-30)15-21(34-13-11-29)16-24(26)36-28/h2-10,15-16,22,25,32H,11-14,17,29-31H2,1H3/t22-,25+,27+,28-/m0/s1 |
| InChIKey | XCWIYFQRHDZYSV-CEYYOHNYSA-N |
| XLogP | 2.62 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|