C27H26BrNO5 — CID 50994764
N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]acetamide (PubChem CID 50994764) has the molecular formula C27H26BrNO5 and a molecular weight of 524.41 g/mol. Its IUPAC name is N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]acetamide.
| Compound Name | N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]acetamide |
|---|---|
| PubChem CID | 50994764 |
| Molecular Formula | C27H26BrNO5 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]acetamide |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3ccccc3)C[C@@H](NC(C)=O)[C@@]21O |
| InChI | InChI=1S/C27H26BrNO5/c1-16(30)29-24-15-21(17-7-5-4-6-8-17)27(18-9-11-19(28)12-10-18)26(24,31)25-22(33-3)13-20(32-2)14-23(25)34-27/h4-14,21,24,31H,15H2,1-3H3,(H,29,30)/t21-,24+,26+,27-/m0/s1 |
| InChIKey | ADORYWVBMAFFJU-MPYVGDORSA-N |
| XLogP | 4.63 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |