C27H28O7 — CID 170732891
6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol;formic acid (PubChem CID 170732891) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is 6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol;formic acid.
| Compound Name | 6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol;formic acid |
|---|---|
| PubChem CID | 170732891 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-8b-ol;formic acid |
| SMILES | COc1ccc(C23Oc4cc(OC)cc(OC)c4C2(O)CCC3c2ccccc2)cc1.O=CO |
| InChI | InChI=1S/C26H26O5.CH2O2/c1-28-19-11-9-18(10-12-19)26-21(17-7-5-4-6-8-17)13-14-25(26,27)24-22(30-3)15-20(29-2)16-23(24)31-26;2-1-3/h4-12,15-16,21,27H,13-14H2,1-3H3;1H,(H,2,3) |
| InChIKey | XKNYLZAKEMGFMT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|