C26H22BO5 — CID 143166809
CID 143166809 (PubChem CID 143166809) has the molecular formula C26H22BO5 and a molecular weight of 425.27 g/mol.
| Compound Name | CID 143166809 |
|---|---|
| PubChem CID | 143166809 |
| Molecular Formula | C26H22BO5 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | — |
| SMILES | [B]=Cc1cc(OC)c2c(c1)OC1(c3ccc(OC)cc3)C(c3ccccc3)CC(=O)[C@@]21O |
| InChI | InChI=1S/C26H22BO5/c1-30-19-10-8-18(9-11-19)26-20(17-6-4-3-5-7-17)14-23(28)25(26,29)24-21(31-2)12-16(15-27)13-22(24)32-26/h3-13,15,20,29H,14H2,1-2H3/t20?,25-,26?/m1/s1 |
| InChIKey | RGLMLEBMOCXIOM-XXBILOIISA-N |
| XLogP | 3.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|