C30H25ClO4 — CID 91483869
(1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-phenylmethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 91483869) has the molecular formula C30H25ClO4 and a molecular weight of 484.98 g/mol. Its IUPAC name is (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-phenylmethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-phenylmethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 91483869 |
| Molecular Formula | C30H25ClO4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-3-phenyl-6-phenylmethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | O[C@H]1C[C@H](c2ccccc2)[C@@]2(c3ccc(Cl)cc3)Oc3cc(OCc4ccccc4)ccc3[C@@]12O |
| InChI | InChI=1S/C30H25ClO4/c31-23-13-11-22(12-14-23)30-26(21-9-5-2-6-10-21)18-28(32)29(30,33)25-16-15-24(17-27(25)35-30)34-19-20-7-3-1-4-8-20/h1-17,26,28,32-33H,18-19H2/t26-,28+,29-,30-/m1/s1 |
| InChIKey | VCGYVTPHGZLQCB-RRFVUZEHSA-N |
| XLogP | 5.94 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |