C29H32ClNO4 — CID 123782942
(1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6-[2-(diethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol (PubChem CID 123782942) has the molecular formula C29H32ClNO4 and a molecular weight of 494.03 g/mol. Its IUPAC name is (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6-[2-(diethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol.
| Compound Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6-[2-(diethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
|---|---|
| PubChem CID | 123782942 |
| Molecular Formula | C29H32ClNO4 |
| Molecular Weight | 494.03 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (1S,3R,3aS,8bR)-3a-(4-chlorophenyl)-6-[2-(diethylamino)ethoxy]-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol |
| SMILES | CCN(CC)CCOc1ccc2c(c1)O[C@]1(c3ccc(Cl)cc3)[C@@H](c3ccccc3)C[C@H](O)[C@]21O |
| InChI | InChI=1S/C29H32ClNO4/c1-3-31(4-2)16-17-34-23-14-15-24-26(18-23)35-29(21-10-12-22(30)13-11-21)25(19-27(32)28(24,29)33)20-8-6-5-7-9-20/h5-15,18,25,27,32-33H,3-4,16-17,19H2,1-2H3/t25-,27+,28-,29-/m1/s1 |
| InChIKey | YYZUNDHHRRMBNJ-KKAKYAENSA-N |
| XLogP | 5.08 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.03 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |