C2ClF7OS — CID 102129742
2,2-difluoro-2-(pentafluoro-λ6-sulfanyl)acetyl chloride (PubChem CID 102129742) has the molecular formula C2ClF7OS and a molecular weight of 240.53 g/mol. Its IUPAC name is 2,2-difluoro-2-(pentafluoro-λ6-sulfanyl)acetyl chloride.
| Compound Name | 2,2-difluoro-2-(pentafluoro-λ6-sulfanyl)acetyl chloride |
|---|---|
| PubChem CID | 102129742 |
| Molecular Formula | C2ClF7OS |
| Molecular Weight | 240.53 g/mol |
| Exact Mass | 239.92 |
| IUPAC Name | 2,2-difluoro-2-(pentafluoro-λ6-sulfanyl)acetyl chloride |
| SMILES | O=C(Cl)C(F)(F)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C2ClF7OS/c3-1(11)2(4,5)12(6,7,8,9)10 |
| InChIKey | SNQWJYPYNWKBMG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|