C28H26BrNO5 — CID 102129996
dibenzyl (4S)-1-(4-bromophenyl)-4-methyl-6-oxopiperidine-3,3-dicarboxylate (PubChem CID 102129996) has the molecular formula C28H26BrNO5 and a molecular weight of 536.42 g/mol. Its IUPAC name is dibenzyl (4S)-1-(4-bromophenyl)-4-methyl-6-oxopiperidine-3,3-dicarboxylate.
| Compound Name | dibenzyl (4S)-1-(4-bromophenyl)-4-methyl-6-oxopiperidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102129996 |
| Molecular Formula | C28H26BrNO5 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | dibenzyl (4S)-1-(4-bromophenyl)-4-methyl-6-oxopiperidine-3,3-dicarboxylate |
| SMILES | C[C@H]1CC(=O)N(c2ccc(Br)cc2)CC1(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H26BrNO5/c1-20-16-25(31)30(24-14-12-23(29)13-15-24)19-28(20,26(32)34-17-21-8-4-2-5-9-21)27(33)35-18-22-10-6-3-7-11-22/h2-15,20H,16-19H2,1H3/t20-/m0/s1 |
| InChIKey | QOHIDQFOCNIUBK-FQEVSTJZSA-N |
| XLogP | 5.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|