C10H15NO6 — CID 102133270
methyl (2S)-2-[5-(2-methoxy-2-oxoethyl)-2-oxo-1,3-oxazolidin-3-yl]propanoate (PubChem CID 102133270) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is methyl (2S)-2-[5-(2-methoxy-2-oxoethyl)-2-oxo-1,3-oxazolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[5-(2-methoxy-2-oxoethyl)-2-oxo-1,3-oxazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 102133270 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | methyl (2S)-2-[5-(2-methoxy-2-oxoethyl)-2-oxo-1,3-oxazolidin-3-yl]propanoate |
| SMILES | COC(=O)CC1CN([C@@H](C)C(=O)OC)C(=O)O1 |
| InChI | InChI=1S/C10H15NO6/c1-6(9(13)16-3)11-5-7(17-10(11)14)4-8(12)15-2/h6-7H,4-5H2,1-3H3/t6-,7?/m0/s1 |
| InChIKey | SGGYDYXAAXEZAW-PKPIPKONSA-N |
| XLogP | -0.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|