C35H52N2O4 — CID 102133776
tert-butyl (2R,3S)-3-(dibenzylamino)-2-(10-methoxy-10-oxodecyl)piperidine-1-carboxylate (PubChem CID 102133776) has the molecular formula C35H52N2O4 and a molecular weight of 564.81 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-(dibenzylamino)-2-(10-methoxy-10-oxodecyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-(dibenzylamino)-2-(10-methoxy-10-oxodecyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102133776 |
| Molecular Formula | C35H52N2O4 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | tert-butyl (2R,3S)-3-(dibenzylamino)-2-(10-methoxy-10-oxodecyl)piperidine-1-carboxylate |
| SMILES | COC(=O)CCCCCCCCC[C@@H]1[C@@H](N(Cc2ccccc2)Cc2ccccc2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H52N2O4/c1-35(2,3)41-34(39)37-26-18-24-31(32(37)23-16-8-6-5-7-9-17-25-33(38)40-4)36(27-29-19-12-10-13-20-29)28-30-21-14-11-15-22-30/h10-15,19-22,31-32H,5-9,16-18,23-28H2,1-4H3/t31-,32+/m0/s1 |
| InChIKey | IPFKOYUKNZGWME-AJQTZOPKSA-N |
| XLogP | 8.14 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|