C26H34N2O3 — CID 177451833
tert-butyl (2R,3S)-3-(dibenzylamino)-2-(2-oxoethyl)piperidine-1-carboxylate (PubChem CID 177451833) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-(dibenzylamino)-2-(2-oxoethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-(dibenzylamino)-2-(2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177451833 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | tert-butyl (2R,3S)-3-(dibenzylamino)-2-(2-oxoethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](N(Cc2ccccc2)Cc2ccccc2)[C@H]1CC=O |
| InChI | InChI=1S/C26H34N2O3/c1-26(2,3)31-25(30)28-17-10-15-23(24(28)16-18-29)27(19-21-11-6-4-7-12-21)20-22-13-8-5-9-14-22/h4-9,11-14,18,23-24H,10,15-17,19-20H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | VHAFNFBRWIJXSK-BJKOFHAPSA-N |
| XLogP | 5.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|