C18H27N4O3P — CID 102136301
1-[(4-carbamoylpiperidin-1-yl)-phenylphosphoryl]piperidine-4-carboxamide (PubChem CID 102136301) has the molecular formula C18H27N4O3P and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-[(4-carbamoylpiperidin-1-yl)-phenylphosphoryl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-carbamoylpiperidin-1-yl)-phenylphosphoryl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 102136301 |
| Molecular Formula | C18H27N4O3P |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[(4-carbamoylpiperidin-1-yl)-phenylphosphoryl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(P(=O)(c2ccccc2)N2CCC(C(N)=O)CC2)CC1 |
| InChI | InChI=1S/C18H27N4O3P/c19-17(23)14-6-10-21(11-7-14)26(25,16-4-2-1-3-5-16)22-12-8-15(9-13-22)18(20)24/h1-5,14-15H,6-13H2,(H2,19,23)(H2,20,24) |
| InChIKey | ZNDBQSDZNIOYRP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|