C18H30O4 — CID 102136680
(1R,3S,4aS,6aS,10aS,10bR)-1-hydroxy-3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-7-one (PubChem CID 102136680) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (1R,3S,4aS,6aS,10aS,10bR)-1-hydroxy-3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-7-one.
| Compound Name | (1R,3S,4aS,6aS,10aS,10bR)-1-hydroxy-3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-7-one |
|---|---|
| PubChem CID | 102136680 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (1R,3S,4aS,6aS,10aS,10bR)-1-hydroxy-3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-7-one |
| SMILES | CC(C)(O)[C@@H]1C[C@@H](O)[C@]2(C)[C@H](CC[C@]3(C)C(=O)CCC[C@@H]23)O1 |
| InChI | InChI=1S/C18H30O4/c1-16(2,21)15-10-13(20)18(4)11-6-5-7-12(19)17(11,3)9-8-14(18)22-15/h11,13-15,20-21H,5-10H2,1-4H3/t11-,13-,14+,15+,17+,18-/m1/s1 |
| InChIKey | ORUMLWHGJJJERY-LWKIJMOLSA-N |
| XLogP | 2.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |