C14H21BrN2O — CID 102137510
trans-(1S,2S)-1-(4-bromophenyl)-2-(2,2-dimethylhydrazinyl)cyclohexan-1-ol (PubChem CID 102137510) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is trans-(1S,2S)-1-(4-bromophenyl)-2-(2,2-dimethylhydrazinyl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-1-(4-bromophenyl)-2-(2,2-dimethylhydrazinyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102137510 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | trans-(1S,2S)-1-(4-bromophenyl)-2-(2,2-dimethylhydrazinyl)cyclohexan-1-ol |
| SMILES | CN(C)N[C@H]1CCCC[C@]1(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H21BrN2O/c1-17(2)16-13-5-3-4-10-14(13,18)11-6-8-12(15)9-7-11/h6-9,13,16,18H,3-5,10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | YKASLHOUFDLMNT-KBPBESRZSA-N |
| XLogP | 2.65 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|