C15H24N2O — CID 102137500
trans-(1S,2S)-2-(2,2-dimethylhydrazinyl)-1-(2-methylphenyl)cyclohexan-1-ol (PubChem CID 102137500) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2,2-dimethylhydrazinyl)-1-(2-methylphenyl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2,2-dimethylhydrazinyl)-1-(2-methylphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102137500 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | trans-(1S,2S)-2-(2,2-dimethylhydrazinyl)-1-(2-methylphenyl)cyclohexan-1-ol |
| SMILES | Cc1ccccc1[C@@]1(O)CCCC[C@@H]1NN(C)C |
| InChI | InChI=1S/C15H24N2O/c1-12-8-4-5-9-13(12)15(18)11-7-6-10-14(15)16-17(2)3/h4-5,8-9,14,16,18H,6-7,10-11H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | PTYYRBCDGZBEQU-GJZGRUSLSA-N |
| XLogP | 2.19 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|