C15H17NO2S — CID 102137996
(3R)-N,N-dimethyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-phenylpropanethioamide (PubChem CID 102137996) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-phenylpropanethioamide.
| Compound Name | (3R)-N,N-dimethyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-phenylpropanethioamide |
|---|---|
| PubChem CID | 102137996 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (3R)-N,N-dimethyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-phenylpropanethioamide |
| SMILES | CN(C)C(=S)C[C@H](c1ccccc1)[C@@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C15H17NO2S/c1-16(2)14(19)10-12(11-6-4-3-5-7-11)13-8-9-15(17)18-13/h3-9,12-13H,10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | YMQPGUXDIXMAAJ-OLZOCXBDSA-N |
| XLogP | 2.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|