C23H23N7 — CID 102139367
N,N-bis[(1-benzyltriazol-4-yl)methyl]prop-2-yn-1-amine (PubChem CID 102139367) has the molecular formula C23H23N7 and a molecular weight of 397.49 g/mol. Its IUPAC name is N,N-bis[(1-benzyltriazol-4-yl)methyl]prop-2-yn-1-amine.
| Compound Name | N,N-bis[(1-benzyltriazol-4-yl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 102139367 |
| Molecular Formula | C23H23N7 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N,N-bis[(1-benzyltriazol-4-yl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCN(Cc1cn(Cc2ccccc2)nn1)Cc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C23H23N7/c1-2-13-28(16-22-18-29(26-24-22)14-20-9-5-3-6-10-20)17-23-19-30(27-25-23)15-21-11-7-4-8-12-21/h1,3-12,18-19H,13-17H2 |
| InChIKey | BYSNSUAVYZKNEG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|