C13H19N7 — CID 122233400
N,N-bis[(1-ethyltriazol-4-yl)methyl]prop-2-yn-1-amine (PubChem CID 122233400) has the molecular formula C13H19N7 and a molecular weight of 273.34 g/mol. Its IUPAC name is N,N-bis[(1-ethyltriazol-4-yl)methyl]prop-2-yn-1-amine.
| Compound Name | N,N-bis[(1-ethyltriazol-4-yl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 122233400 |
| Molecular Formula | C13H19N7 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N,N-bis[(1-ethyltriazol-4-yl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCN(Cc1cn(CC)nn1)Cc1cn(CC)nn1 |
| InChI | InChI=1S/C13H19N7/c1-4-7-18(8-12-10-19(5-2)16-14-12)9-13-11-20(6-3)17-15-13/h1,10-11H,5-9H2,2-3H3 |
| InChIKey | NGYATILOIJFCAA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|