C17H16ClNO4 — CID 102140324
(1S,3S)-1-(2-chloro-5-nitrophenyl)-6-methoxy-3-methyl-3,4-dihydro-1H-isochromene (PubChem CID 102140324) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is (1S,3S)-1-(2-chloro-5-nitrophenyl)-6-methoxy-3-methyl-3,4-dihydro-1H-isochromene.
| Compound Name | (1S,3S)-1-(2-chloro-5-nitrophenyl)-6-methoxy-3-methyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 102140324 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (1S,3S)-1-(2-chloro-5-nitrophenyl)-6-methoxy-3-methyl-3,4-dihydro-1H-isochromene |
| SMILES | COc1ccc2c(c1)C[C@H](C)O[C@@H]2c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H16ClNO4/c1-10-7-11-8-13(22-2)4-5-14(11)17(23-10)15-9-12(19(20)21)3-6-16(15)18/h3-6,8-10,17H,7H2,1-2H3/t10-,17-/m0/s1 |
| InChIKey | UDISHSFENXDICJ-BTDLBPIBSA-N |
| XLogP | 4.31 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|