C14H22O — CID 102142055
1-(2,3-dibutylcycloprop-2-en-1-yl)prop-2-yn-1-ol (PubChem CID 102142055) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(2,3-dibutylcycloprop-2-en-1-yl)prop-2-yn-1-ol.
| Compound Name | 1-(2,3-dibutylcycloprop-2-en-1-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 102142055 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1-(2,3-dibutylcycloprop-2-en-1-yl)prop-2-yn-1-ol |
| SMILES | C#CC(O)C1C(CCCC)=C1CCCC |
| InChI | InChI=1S/C14H22O/c1-4-7-9-11-12(10-8-5-2)14(11)13(15)6-3/h3,13-15H,4-5,7-10H2,1-2H3 |
| InChIKey | QTHPLZLTYJMIOZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|