C13H22OSi — CID 102142056
1-(2-butyl-3-trimethylsilylcycloprop-2-en-1-yl)prop-2-yn-1-ol (PubChem CID 102142056) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is 1-(2-butyl-3-trimethylsilylcycloprop-2-en-1-yl)prop-2-yn-1-ol.
| Compound Name | 1-(2-butyl-3-trimethylsilylcycloprop-2-en-1-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 102142056 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-(2-butyl-3-trimethylsilylcycloprop-2-en-1-yl)prop-2-yn-1-ol |
| SMILES | C#CC(O)C1C(CCCC)=C1[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi/c1-6-8-9-10-12(11(14)7-2)13(10)15(3,4)5/h2,11-12,14H,6,8-9H2,1,3-5H3 |
| InChIKey | HHHYCXCQAFBSRU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|