C17H30OSi — CID 25147024
(3R,6R)-6,10-dimethyl-5-methylidene-1-trimethylsilylundec-9-en-1-yn-3-ol (PubChem CID 25147024) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is (3R,6R)-6,10-dimethyl-5-methylidene-1-trimethylsilylundec-9-en-1-yn-3-ol.
| Compound Name | (3R,6R)-6,10-dimethyl-5-methylidene-1-trimethylsilylundec-9-en-1-yn-3-ol |
|---|---|
| PubChem CID | 25147024 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3R,6R)-6,10-dimethyl-5-methylidene-1-trimethylsilylundec-9-en-1-yn-3-ol |
| SMILES | C=C(C[C@@H](O)C#C[Si](C)(C)C)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C17H30OSi/c1-14(2)9-8-10-15(3)16(4)13-17(18)11-12-19(5,6)7/h9,15,17-18H,4,8,10,13H2,1-3,5-7H3/t15-,17+/m1/s1 |
| InChIKey | BCGRDKPOQPGKBH-WBVHZDCISA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|