C11H15F2NO5 — CID 102143690
ethyl (1S)-1-[(2R)-1,1-difluoro-3-nitropropan-2-yl]-2-oxocyclopentane-1-carboxylate (PubChem CID 102143690) has the molecular formula C11H15F2NO5 and a molecular weight of 279.24 g/mol. Its IUPAC name is ethyl (1S)-1-[(2R)-1,1-difluoro-3-nitropropan-2-yl]-2-oxocyclopentane-1-carboxylate.
| Compound Name | ethyl (1S)-1-[(2R)-1,1-difluoro-3-nitropropan-2-yl]-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102143690 |
| Molecular Formula | C11H15F2NO5 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl (1S)-1-[(2R)-1,1-difluoro-3-nitropropan-2-yl]-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1([C@H](C[N+](=O)[O-])C(F)F)CCCC1=O |
| InChI | InChI=1S/C11H15F2NO5/c1-2-19-10(16)11(5-3-4-8(11)15)7(9(12)13)6-14(17)18/h7,9H,2-6H2,1H3/t7-,11+/m1/s1 |
| InChIKey | UFULUDKRXFLIRV-HQJQHLMTSA-N |
| XLogP | 1.45 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|