C13H20NO2P — CID 102144029
(E)-3-[ethoxy(phenyl)phosphoryl]-N,N-dimethylprop-2-en-1-amine (PubChem CID 102144029) has the molecular formula C13H20NO2P and a molecular weight of 253.28 g/mol. Its IUPAC name is (E)-3-[ethoxy(phenyl)phosphoryl]-N,N-dimethylprop-2-en-1-amine.
| Compound Name | (E)-3-[ethoxy(phenyl)phosphoryl]-N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 102144029 |
| Molecular Formula | C13H20NO2P |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (E)-3-[ethoxy(phenyl)phosphoryl]-N,N-dimethylprop-2-en-1-amine |
| SMILES | CCOP(=O)(/C=C/CN(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H20NO2P/c1-4-16-17(15,12-8-11-14(2)3)13-9-6-5-7-10-13/h5-10,12H,4,11H2,1-3H3/b12-8+ |
| InChIKey | ZBPXBFQFGLSMIE-XYOKQWHBSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|