C20H35NO6P2 — CID 101272794
N-[(E)-5,5-bis(diethoxyphosphoryl)pent-2-enyl]-N-methylaniline (PubChem CID 101272794) has the molecular formula C20H35NO6P2 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-[(E)-5,5-bis(diethoxyphosphoryl)pent-2-enyl]-N-methylaniline.
| Compound Name | N-[(E)-5,5-bis(diethoxyphosphoryl)pent-2-enyl]-N-methylaniline |
|---|---|
| PubChem CID | 101272794 |
| Molecular Formula | C20H35NO6P2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[(E)-5,5-bis(diethoxyphosphoryl)pent-2-enyl]-N-methylaniline |
| SMILES | CCOP(=O)(OCC)C(C/C=C/CN(C)c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H35NO6P2/c1-6-24-28(22,25-7-2)20(29(23,26-8-3)27-9-4)17-13-14-18-21(5)19-15-11-10-12-16-19/h10-16,20H,6-9,17-18H2,1-5H3/b14-13+ |
| InChIKey | OWZZUFPJUXNIPV-BUHFOSPRSA-N |
| XLogP | 5.93 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|