C26H35N3O2 — CID 102144304
2-[3-(3,5-dihexoxyphenyl)-1H-pyrazol-5-yl]pyridine (PubChem CID 102144304) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[3-(3,5-dihexoxyphenyl)-1H-pyrazol-5-yl]pyridine.
| Compound Name | 2-[3-(3,5-dihexoxyphenyl)-1H-pyrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 102144304 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 2-[3-(3,5-dihexoxyphenyl)-1H-pyrazol-5-yl]pyridine |
| SMILES | CCCCCCOc1cc(OCCCCCC)cc(-c2cc(-c3ccccn3)[nH]n2)c1 |
| InChI | InChI=1S/C26H35N3O2/c1-3-5-7-11-15-30-22-17-21(18-23(19-22)31-16-12-8-6-4-2)25-20-26(29-28-25)24-13-9-10-14-27-24/h9-10,13-14,17-20H,3-8,11-12,15-16H2,1-2H3,(H,28,29) |
| InChIKey | OGKMLALCLWPSCG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|