C23H23NO5 — CID 102144331
1-[(2S,3S,4S,5R,6R)-2-methoxy-2-methyl-5-nitro-4-phenyl-6-(2-phenylethynyl)oxan-3-yl]ethanone (PubChem CID 102144331) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5R,6R)-2-methoxy-2-methyl-5-nitro-4-phenyl-6-(2-phenylethynyl)oxan-3-yl]ethanone.
| Compound Name | 1-[(2S,3S,4S,5R,6R)-2-methoxy-2-methyl-5-nitro-4-phenyl-6-(2-phenylethynyl)oxan-3-yl]ethanone |
|---|---|
| PubChem CID | 102144331 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[(2S,3S,4S,5R,6R)-2-methoxy-2-methyl-5-nitro-4-phenyl-6-(2-phenylethynyl)oxan-3-yl]ethanone |
| SMILES | CO[C@@]1(C)O[C@H](C#Cc2ccccc2)[C@H]([N+](=O)[O-])[C@H](c2ccccc2)[C@H]1C(C)=O |
| InChI | InChI=1S/C23H23NO5/c1-16(25)21-20(18-12-8-5-9-13-18)22(24(26)27)19(29-23(21,2)28-3)15-14-17-10-6-4-7-11-17/h4-13,19-22H,1-3H3/t19-,20-,21-,22+,23+/m1/s1 |
| InChIKey | PKYDMLHAUJPDRZ-CCSDVLNMSA-N |
| XLogP | 3.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|